![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/ball.red.gif){kind=icon}
![[ ]](/icons/tar.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| README | 2004-12-21 12:04 | 3.2K | |
| lmc_sc1.tar | 2004-12-21 12:02 | 2.0M | |
| lmc_sc1/ | 2004-12-16 06:47 | - | |
| lmc_sc10.tar | 2004-12-21 12:02 | 2.1M | |
| lmc_sc10/ | 2004-12-16 06:48 | - | |
| lmc_sc11.tar | 2004-12-21 12:02 | 1.6M | |
| lmc_sc11/ | 2004-12-16 06:50 | - | |
| lmc_sc12.tar | 2004-12-21 12:02 | 1.3M | |
| lmc_sc12/ | 2004-12-16 06:50 | - | |
| lmc_sc13.tar | 2004-12-21 12:02 | 1.2M | |
| lmc_sc13/ | 2004-12-16 06:51 | - | |
| lmc_sc14.tar | 2004-12-21 12:02 | 1.2M | |
| lmc_sc14/ | 2004-12-16 06:51 | - | |
| lmc_sc15.tar | 2004-12-21 12:02 | 860K | |
| lmc_sc15/ | 2004-12-16 06:51 | - | |
| lmc_sc16.tar | 2004-12-21 12:02 | 1.2M | |
| lmc_sc16/ | 2004-12-16 06:51 | - | |
| lmc_sc17.tar | 2004-12-21 12:02 | 1.1M | |
| lmc_sc17/ | 2004-12-16 06:51 | - | |
| lmc_sc18.tar | 2004-12-21 12:02 | 760K | |
| lmc_sc18/ | 2004-12-16 06:51 | - | |
| lmc_sc19.tar | 2004-12-21 12:02 | 670K | |
| lmc_sc19/ | 2004-12-16 06:51 | - | |
| lmc_sc2.tar | 2004-12-21 12:02 | 2.5M | |
| lmc_sc2/ | 2004-12-16 06:47 | - | |
| lmc_sc20.tar | 2004-12-21 12:02 | 880K | |
| lmc_sc20/ | 2004-12-16 06:51 | - | |
| lmc_sc21.tar | 2004-12-21 12:02 | 1.2M | |
| lmc_sc21/ | 2004-12-16 06:52 | - | |
| lmc_sc3.tar | 2004-12-21 12:02 | 2.4M | |
| lmc_sc3/ | 2004-12-16 06:47 | - | |
| lmc_sc4.tar | 2004-12-21 12:02 | 2.9M | |
| lmc_sc4/ | 2004-12-16 06:47 | - | |
| lmc_sc5.tar | 2004-12-21 12:02 | 2.8M | |
| lmc_sc5/ | 2004-12-16 06:47 | - | |
| lmc_sc6.tar | 2004-12-21 12:02 | 2.5M | |
| lmc_sc6/ | 2004-12-16 06:47 | - | |
| lmc_sc7.tar | 2004-12-21 12:02 | 2.6M | |
| lmc_sc7/ | 2004-12-16 06:47 | - | |
| lmc_sc8.tar | 2004-12-21 12:02 | 2.4M | |
| lmc_sc8/ | 2004-12-16 06:48 | - | |
| lmc_sc9.tar | 2004-12-21 12:02 | 1.9M | |
| lmc_sc9/ | 2004-12-16 06:48 | - | |
| paper/ | 2004-12-20 05:31 | - | |
This directory contains photometric data of ellipsoidal and eclipsing
red giants in the Large Magellanic Cloud.
---------------------------------------------------------------------------
The directory structure is as follows:
README - this file
subdirectory paper/ - Paper: "The Optical Gravitational Lensing
Experiment. Ellipsoidal Variability of
Red Giants in the Large Magellanic Cloud"
by
I. Soszynski, A. Udalski, M. Kubiak,
M.K. Szymanski, G. Pietrzynski,
K. Zebrun, O. Szewczyk, L. Wyrzykowski,
and W.A. Dziembowski
Acta Astron. 2004, 54, 347
(astro-ph/0412505)
subdirectories lmc_sc*/ - the data of the ellipsoidal and eclipsing
red giants in the field LMC_SC*
subdirectories lmc_sc*/fcharts/ - finding charts of individual objects;
gzipped Postscript version. The file
names are: object_id.ps.gz.
The finding chart is a 60"x60" part of
the I-band frame, centered on the star.
White cross marks the star. North is up
and East to the left.
subdirectories lmc_sc*/phot/I/ - I-band photometry of individual objects.
subdirectories lmc_sc*/phot/V/ - V-band photometry of individual objects.
subdirectories lmc_sc*/phot/B/ - B-band photometry of individual objects.
The file names are: object_id.dat.gz.
Each file contains three columns: HJD,
magnitude, error.
files lmc_sc*/lmc_sc*.ell - Tables containing basic data of the
candidates for ellipsoidal red giants
in the field LMC_SC*
files lmc_sc*/lmc_sc*.ecl - Tables containing basic data of the
eclipsing variables in the field LMC_SC*
The columns in the tables are as follows:
star ID, star number (consistent with
published LMC maps), RA (J2000), DEC
(J2000), P (days), T_0 (HJD), I, V, B,
larger I-band amplitude, smaller I-band
amplitude, remarks.
Remarks: U - uncertain, E - eccentric
orbit, LMC_SC* - the same star in the
field LMC_SC*.
files lmc_sc*.tar - tar archive containing all data from
the subdirectory lmc_sc*.
---------------------------------------------------------------------------
Any presentation of the scientific analysis or usage of the data from this
directory should include the appropriate reference(s) to OGLE paper(s).